C18H31IN4O — CID 109418513
1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[(1-methylpyrrolidin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 109418513) has the molecular formula C18H31IN4O and a molecular weight of 446.38 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[(1-methylpyrrolidin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[(1-methylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109418513 |
| Molecular Formula | C18H31IN4O |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[(1-methylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCC1CCCN1C.I |
| InChI | InChI=1S/C18H30N4O.HI/c1-4-19-17(20-13-16-11-8-12-22(16)3)21-14-18(2,23)15-9-6-5-7-10-15;/h5-7,9-10,16,23H,4,8,11-14H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | SIWRTXWBRWUQSY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|