C17H31N5O — CID 119163309
1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-(2,2,3,3-tetramethylcyclopropyl)guanidine (PubChem CID 119163309) has the molecular formula C17H31N5O and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-(2,2,3,3-tetramethylcyclopropyl)guanidine.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-(2,2,3,3-tetramethylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 119163309 |
| Molecular Formula | C17H31N5O |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-(2,2,3,3-tetramethylcyclopropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C17H31N5O/c1-8-18-14(21-13-15(2,3)16(13,4)5)19-11-17(6,23)12-9-20-22(7)10-12/h9-10,13,23H,8,11H2,1-7H3,(H2,18,19,21) |
| InChIKey | XSPBCZKFSGXNBQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|