C19H38N6O — CID 111656164
1-[2-(dimethylamino)-3-ethylpentyl]-3-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine (PubChem CID 111656164) has the molecular formula C19H38N6O and a molecular weight of 366.55 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-3-ethylpentyl]-3-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine.
| Compound Name | 1-[2-(dimethylamino)-3-ethylpentyl]-3-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111656164 |
| Molecular Formula | C19H38N6O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 1-[2-(dimethylamino)-3-ethylpentyl]-3-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCC(C(CC)CC)N(C)C |
| InChI | InChI=1S/C19H38N6O/c1-8-15(9-2)17(24(5)6)12-21-18(20-10-3)22-14-19(4,26)16-11-23-25(7)13-16/h11,13,15,17,26H,8-10,12,14H2,1-7H3,(H2,20,21,22) |
| InChIKey | NRWVECJUIIIDJO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|