C19H37IN4OS — CID 109420357
1-[2-(dimethylamino)-3-ethylpentyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109420357) has the molecular formula C19H37IN4OS and a molecular weight of 496.50 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-3-ethylpentyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(dimethylamino)-3-ethylpentyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420357 |
| Molecular Formula | C19H37IN4OS |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 1-[2-(dimethylamino)-3-ethylpentyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCC(C(CC)CC)N(C)C.I |
| InChI | InChI=1S/C19H36N4OS.HI/c1-7-15(8-2)16(23(5)6)13-21-18(20-9-3)22-14-19(4,24)17-11-10-12-25-17;/h10-12,15-16,24H,7-9,13-14H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | ZEISGHOAKHMJPC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|