C18H34N4OS — CID 109419600
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine (PubChem CID 109419600) has the molecular formula C18H34N4OS and a molecular weight of 354.56 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine |
|---|---|
| PubChem CID | 109419600 |
| Molecular Formula | C18H34N4OS |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-[methyl(propan-2-yl)amino]butyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCCN(C)C(C)C |
| InChI | InChI=1S/C18H34N4OS/c1-6-19-17(20-11-7-8-12-22(5)15(2)3)21-14-18(4,23)16-10-9-13-24-16/h9-10,13,15,23H,6-8,11-12,14H2,1-5H3,(H2,19,20,21) |
| InChIKey | OMKJXLCTPWPZPC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|