C17H31N3O3S — CID 109420628
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-(2-methoxyethoxy)butyl]guanidine (PubChem CID 109420628) has the molecular formula C17H31N3O3S and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-(2-methoxyethoxy)butyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-(2-methoxyethoxy)butyl]guanidine |
|---|---|
| PubChem CID | 109420628 |
| Molecular Formula | C17H31N3O3S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[4-(2-methoxyethoxy)butyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCCOCCOC |
| InChI | InChI=1S/C17H31N3O3S/c1-4-18-16(19-9-5-6-10-23-12-11-22-3)20-14-17(2,21)15-8-7-13-24-15/h7-8,13,21H,4-6,9-12,14H2,1-3H3,(H2,18,19,20) |
| InChIKey | RQDXVCQBGSZCBD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|