C13H22FN3OS — CID 109419502
1-ethyl-3-(3-fluoropropyl)-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine (PubChem CID 109419502) has the molecular formula C13H22FN3OS and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-ethyl-3-(3-fluoropropyl)-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-(3-fluoropropyl)-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109419502 |
| Molecular Formula | C13H22FN3OS |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-ethyl-3-(3-fluoropropyl)-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCF |
| InChI | InChI=1S/C13H22FN3OS/c1-3-15-12(16-8-5-7-14)17-10-13(2,18)11-6-4-9-19-11/h4,6,9,18H,3,5,7-8,10H2,1-2H3,(H2,15,16,17) |
| InChIKey | XGJDSBMDQZSHSJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|