C15H27N3OS2 — CID 109419542
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(4-methylsulfanylbutyl)guanidine (PubChem CID 109419542) has the molecular formula C15H27N3OS2 and a molecular weight of 329.54 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(4-methylsulfanylbutyl)guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(4-methylsulfanylbutyl)guanidine |
|---|---|
| PubChem CID | 109419542 |
| Molecular Formula | C15H27N3OS2 |
| Molecular Weight | 329.54 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(4-methylsulfanylbutyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCCSC |
| InChI | InChI=1S/C15H27N3OS2/c1-4-16-14(17-9-5-6-10-20-3)18-12-15(2,19)13-8-7-11-21-13/h7-8,11,19H,4-6,9-10,12H2,1-3H3,(H2,16,17,18) |
| InChIKey | BSIPRQWSKKAOEI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|