C12H19F2N3OS — CID 109419270
1-(2,2-difluoroethyl)-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine (PubChem CID 109419270) has the molecular formula C12H19F2N3OS and a molecular weight of 291.37 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-(2,2-difluoroethyl)-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109419270 |
| Molecular Formula | C12H19F2N3OS |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCC(F)F |
| InChI | InChI=1S/C12H19F2N3OS/c1-3-15-11(16-7-10(13)14)17-8-12(2,18)9-5-4-6-19-9/h4-6,10,18H,3,7-8H2,1-2H3,(H2,15,16,17) |
| InChIKey | RGQISCYZUXRJMS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|