C20H29F2IN4OS — CID 109418959
1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109418959) has the molecular formula C20H29F2IN4OS and a molecular weight of 538.45 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109418959 |
| Molecular Formula | C20H29F2IN4OS |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCC(c1c(F)cccc1F)N(C)C.I |
| InChI | InChI=1S/C20H28F2N4OS.HI/c1-5-23-19(25-13-20(2,27)17-10-7-11-28-17)24-12-16(26(3)4)18-14(21)8-6-9-15(18)22;/h6-11,16,27H,5,12-13H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | LZIUIWXMVWNXIR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|