C19H32F2IN5O — CID 111797329
N-tert-butyl-2-[[[[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111797329) has the molecular formula C19H32F2IN5O and a molecular weight of 511.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[[[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[[[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111797329 |
| Molecular Formula | C19H32F2IN5O |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | N-tert-butyl-2-[[[[2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC(c1c(F)cccc1F)N(C)C.I |
| InChI | InChI=1S/C19H31F2N5O.HI/c1-7-22-18(24-12-16(27)25-19(2,3)4)23-11-15(26(5)6)17-13(20)9-8-10-14(17)21;/h8-10,15H,7,11-12H2,1-6H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | BDJFJABLKWYIPW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|