C17H33N7O — CID 111797332
N-tert-butyl-2-[[[[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]amino]-(ethylamino)methylidene]amino]acetamide (PubChem CID 111797332) has the molecular formula C17H33N7O and a molecular weight of 351.50 g/mol. Its IUPAC name is N-tert-butyl-2-[[[[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]amino]-(ethylamino)methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[[[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]amino]-(ethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111797332 |
| Molecular Formula | C17H33N7O |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | N-tert-butyl-2-[[[[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]amino]-(ethylamino)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC(c1cnn(C)c1)N(C)C |
| InChI | InChI=1S/C17H33N7O/c1-8-18-16(20-11-15(25)22-17(2,3)4)19-10-14(23(5)6)13-9-21-24(7)12-13/h9,12,14H,8,10-11H2,1-7H3,(H,22,25)(H2,18,19,20) |
| InChIKey | SONIDMHZJDGNHP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|