C19H33ClIN5O — CID 111755378
N-tert-butyl-2-[[[[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111755378) has the molecular formula C19H33ClIN5O and a molecular weight of 509.86 g/mol. Its IUPAC name is N-tert-butyl-2-[[[[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[[[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111755378 |
| Molecular Formula | C19H33ClIN5O |
| Molecular Weight | 509.86 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-tert-butyl-2-[[[[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]amino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCC(c1ccc(Cl)cc1)N(C)C.I |
| InChI | InChI=1S/C19H32ClN5O.HI/c1-7-21-18(23-13-17(26)24-19(2,3)4)22-12-16(25(5)6)14-8-10-15(20)11-9-14;/h8-11,16H,7,12-13H2,1-6H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | XVLQIEWULRYHDW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.86 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|