C19H29ClIN5S — CID 111987258
1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111987258) has the molecular formula C19H29ClIN5S and a molecular weight of 521.90 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111987258 |
| Molecular Formula | C19H29ClIN5S |
| Molecular Weight | 521.90 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1sc(C)nc1C)NCC(c1ccc(Cl)cc1)N(C)C.I |
| InChI | InChI=1S/C19H28ClN5S.HI/c1-6-21-19(23-12-18-13(2)24-14(3)26-18)22-11-17(25(4)5)15-7-9-16(20)10-8-15;/h7-10,17H,6,11-12H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | SSEMOEPAQDGLTD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.90 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|