C15H21ClIN5O — CID 75512847
1-[1-(4-chlorophenyl)ethyl]-3-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 75512847) has the molecular formula C15H21ClIN5O and a molecular weight of 449.72 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethyl]-3-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(4-chlorophenyl)ethyl]-3-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 75512847 |
| Molecular Formula | C15H21ClIN5O |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethyl]-3-ethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1noc(C)n1)NC(C)c1ccc(Cl)cc1.I |
| InChI | InChI=1S/C15H20ClN5O.HI/c1-4-17-15(18-9-14-20-11(3)22-21-14)19-10(2)12-5-7-13(16)8-6-12;/h5-8,10H,4,9H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | FJSQWERXHCOKMT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|