C13H15Cl2N5O — CID 111814197
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine (PubChem CID 111814197) has the molecular formula C13H15Cl2N5O and a molecular weight of 328.20 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111814197 |
| Molecular Formula | C13H15Cl2N5O |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine |
| SMILES | Cc1nc(C/N=C(\N)NC(C)c2ccc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C13H15Cl2N5O/c1-7(10-4-3-9(14)5-11(10)15)18-13(16)17-6-12-19-8(2)21-20-12/h3-5,7H,6H2,1-2H3,(H3,16,17,18) |
| InChIKey | CHYVBOAPYRYBFW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|