C11H16Cl2IN3O — CID 111023048
1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-hydroxyethyl)guanidine;hydroiodide (PubChem CID 111023048) has the molecular formula C11H16Cl2IN3O and a molecular weight of 404.08 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-hydroxyethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-hydroxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111023048 |
| Molecular Formula | C11H16Cl2IN3O |
| Molecular Weight | 404.08 g/mol |
| Exact Mass | 402.97 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-hydroxyethyl)guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/CCO)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C11H15Cl2N3O.HI/c1-7(16-11(14)15-4-5-17)9-3-2-8(12)6-10(9)13;/h2-3,6-7,17H,4-5H2,1H3,(H3,14,15,16);1H |
| InChIKey | OSLGAJAETWUUAS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.08 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|