C16H24Cl2IN3O — CID 110018764
1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(oxan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 110018764) has the molecular formula C16H24Cl2IN3O and a molecular weight of 472.20 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(oxan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(oxan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110018764 |
| Molecular Formula | C16H24Cl2IN3O |
| Molecular Weight | 472.20 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(oxan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/CCC1CCCCO1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C16H23Cl2N3O.HI/c1-11(14-6-5-12(17)10-15(14)18)21-16(19)20-8-7-13-4-2-3-9-22-13;/h5-6,10-11,13H,2-4,7-9H2,1H3,(H3,19,20,21);1H |
| InChIKey | MDJNASMYZFHAOV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|