C19H27Cl2IN6O — CID 111542107
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111542107) has the molecular formula C19H27Cl2IN6O and a molecular weight of 553.28 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111542107 |
| Molecular Formula | C19H27Cl2IN6O |
| Molecular Weight | 553.28 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(\NCC2CCCO2)NC(C)c2ccc(Cl)cc2Cl)n1C.I |
| InChI | InChI=1S/C19H26Cl2N6O.HI/c1-12(16-7-6-14(20)9-17(16)21)24-19(22-10-15-5-4-8-28-15)23-11-18-26-25-13(2)27(18)3;/h6-7,9,12,15H,4-5,8,10-11H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | FQYIHEUYXHCHAK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|