C18H29IN6O2 — CID 111655211
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[1-(5-methylfuran-2-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111655211) has the molecular formula C18H29IN6O2 and a molecular weight of 488.37 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[1-(5-methylfuran-2-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[1-(5-methylfuran-2-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111655211 |
| Molecular Formula | C18H29IN6O2 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[1-(5-methylfuran-2-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | Cc1ccc(C(C)N/C(=N/Cc2nnc(C)n2C)NCC2CCCO2)o1.I |
| InChI | InChI=1S/C18H28N6O2.HI/c1-12-7-8-16(26-12)13(2)21-18(19-10-15-6-5-9-25-15)20-11-17-23-22-14(3)24(17)4;/h7-8,13,15H,5-6,9-11H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | AOZWTFNWRKLFNT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|