C15H29IN6O — CID 111493817
1-tert-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111493817) has the molecular formula C15H29IN6O and a molecular weight of 436.34 g/mol. Its IUPAC name is 1-tert-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111493817 |
| Molecular Formula | C15H29IN6O |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 1-tert-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(\NCC2CCCO2)NC(C)(C)C)n1C.I |
| InChI | InChI=1S/C15H28N6O.HI/c1-11-19-20-13(21(11)5)10-17-14(18-15(2,3)4)16-9-12-7-6-8-22-12;/h12H,6-10H2,1-5H3,(H2,16,17,18);1H |
| InChIKey | UOVKCCZFSZFXLR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|