C17H31IN6O — CID 111541157
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-methyl-N-(oxolan-2-ylmethyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 111541157) has the molecular formula C17H31IN6O and a molecular weight of 462.38 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-methyl-N-(oxolan-2-ylmethyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-methyl-N-(oxolan-2-ylmethyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111541157 |
| Molecular Formula | C17H31IN6O |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-methyl-N-(oxolan-2-ylmethyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | Cc1nnc(C/N=C(\NCC2CCCO2)N2CCC(C)CC2)n1C.I |
| InChI | InChI=1S/C17H30N6O.HI/c1-13-6-8-23(9-7-13)17(18-11-15-5-4-10-24-15)19-12-16-21-20-14(2)22(16)3;/h13,15H,4-12H2,1-3H3,(H,18,19);1H |
| InChIKey | QODJDQUYLLENDT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|