C15H29IN6O2 — CID 111892822
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-ethoxyethyl)-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111892822) has the molecular formula C15H29IN6O2 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-ethoxyethyl)-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-ethoxyethyl)-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111892822 |
| Molecular Formula | C15H29IN6O2 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-ethoxyethyl)-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCOCCN/C(=N\Cc1nnc(C)n1C)NCC1CCCO1.I |
| InChI | InChI=1S/C15H28N6O2.HI/c1-4-22-9-7-16-15(17-10-13-6-5-8-23-13)18-11-14-20-19-12(2)21(14)3;/h13H,4-11H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | QCRKURABHINBBA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|