C23H36N6O3 — CID 111541466
1-[2-(3,4-diethoxyphenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111541466) has the molecular formula C23H36N6O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111541466 |
| Molecular Formula | C23H36N6O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | CCOc1ccc(CCN/C(=N/Cc2nnc(C)n2C)NCC2CCCO2)cc1OCC |
| InChI | InChI=1S/C23H36N6O3/c1-5-30-20-10-9-18(14-21(20)31-6-2)11-12-24-23(25-15-19-8-7-13-32-19)26-16-22-28-27-17(3)29(22)4/h9-10,14,19H,5-8,11-13,15-16H2,1-4H3,(H2,24,25,26) |
| InChIKey | VJUHPEPPESEFBD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|