C17H26N6OS — CID 111651220
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(oxolan-2-ylmethyl)-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111651220) has the molecular formula C17H26N6OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(oxolan-2-ylmethyl)-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(oxolan-2-ylmethyl)-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111651220 |
| Molecular Formula | C17H26N6OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(oxolan-2-ylmethyl)-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | Cc1nnc(C/N=C(\NCCc2cccs2)NCC2CCCO2)n1C |
| InChI | InChI=1S/C17H26N6OS/c1-13-21-22-16(23(13)2)12-20-17(19-11-14-5-3-9-24-14)18-8-7-15-6-4-10-25-15/h4,6,10,14H,3,5,7-9,11-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | PZJHRDHTRFYORT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|