C19H25N7S — CID 111349126
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-pyridin-2-ylethyl)-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111349126) has the molecular formula C19H25N7S and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-pyridin-2-ylethyl)-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-pyridin-2-ylethyl)-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111349126 |
| Molecular Formula | C19H25N7S |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-pyridin-2-ylethyl)-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | Cc1nnc(C/N=C(/NCCc2ccccn2)NCCc2cccs2)n1C |
| InChI | InChI=1S/C19H25N7S/c1-15-24-25-18(26(15)2)14-23-19(22-12-9-17-7-5-13-27-17)21-11-8-16-6-3-4-10-20-16/h3-7,10,13H,8-9,11-12,14H2,1-2H3,(H2,21,22,23) |
| InChIKey | AMLIHVQFVHRUIX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|