C23H32N8 — CID 111194468
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(N-methylanilino)propyl]-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111194468) has the molecular formula C23H32N8 and a molecular weight of 420.57 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(N-methylanilino)propyl]-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(N-methylanilino)propyl]-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111194468 |
| Molecular Formula | C23H32N8 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(N-methylanilino)propyl]-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | Cc1nnc(C/N=C(/NCCCN(C)c2ccccc2)NCCc2ccccn2)n1C |
| InChI | InChI=1S/C23H32N8/c1-19-28-29-22(31(19)3)18-27-23(26-16-13-20-10-7-8-14-24-20)25-15-9-17-30(2)21-11-5-4-6-12-21/h4-8,10-12,14H,9,13,15-18H2,1-3H3,(H2,25,26,27) |
| InChIKey | PUJLLPWUSGWSLT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|