C22H31N7S — CID 111375854
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-3-[3-(N-methylanilino)propyl]-1-(thiophen-3-ylmethyl)guanidine (PubChem CID 111375854) has the molecular formula C22H31N7S and a molecular weight of 425.61 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-3-[3-(N-methylanilino)propyl]-1-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-3-[3-(N-methylanilino)propyl]-1-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111375854 |
| Molecular Formula | C22H31N7S |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-3-[3-(N-methylanilino)propyl]-1-(thiophen-3-ylmethyl)guanidine |
| SMILES | Cc1nnc(C/N=C(/NCCCN(C)c2ccccc2)N(C)Cc2ccsc2)n1C |
| InChI | InChI=1S/C22H31N7S/c1-18-25-26-21(29(18)4)15-24-22(28(3)16-19-11-14-30-17-19)23-12-8-13-27(2)20-9-6-5-7-10-20/h5-7,9-11,14,17H,8,12-13,15-16H2,1-4H3,(H,23,24) |
| InChIKey | KURLPSIIOZHLSF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|