C24H34IN7 — CID 111135232
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(N-methylanilino)propyl]-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111135232) has the molecular formula C24H34IN7 and a molecular weight of 547.49 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(N-methylanilino)propyl]-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(N-methylanilino)propyl]-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111135232 |
| Molecular Formula | C24H34IN7 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(N-methylanilino)propyl]-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(/NCCCN(C)c2ccccc2)NCCc2ccccc2)n1C.I |
| InChI | InChI=1S/C24H33N7.HI/c1-20-28-29-23(31(20)3)19-27-24(26-17-15-21-11-6-4-7-12-21)25-16-10-18-30(2)22-13-8-5-9-14-22;/h4-9,11-14H,10,15-19H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | GGOCZEXMXZLMFG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|