C23H36IN7O2 — CID 111255096
methyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-[3-(N-methylanilino)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111255096) has the molecular formula C23H36IN7O2 and a molecular weight of 569.49 g/mol. Its IUPAC name is methyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-[3-(N-methylanilino)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-[3-(N-methylanilino)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111255096 |
| Molecular Formula | C23H36IN7O2 |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | methyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-[3-(N-methylanilino)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | COC(=O)C1CCN(/C(=N/Cc2nnc(C)n2C)NCCCN(C)c2ccccc2)CC1.I |
| InChI | InChI=1S/C23H35N7O2.HI/c1-18-26-27-21(29(18)3)17-25-23(30-15-11-19(12-16-30)22(31)32-4)24-13-8-14-28(2)20-9-6-5-7-10-20;/h5-7,9-10,19H,8,11-17H2,1-4H3,(H,24,25);1H |
| InChIKey | OLPUOIHADYUIKX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|