C19H29IN6O2S — CID 111156400
ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111156400) has the molecular formula C19H29IN6O2S and a molecular weight of 532.45 g/mol. Its IUPAC name is ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111156400 |
| Molecular Formula | C19H29IN6O2S |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/Cc2nnc(C)n2C)NCc2cccs2)CC1.I |
| InChI | InChI=1S/C19H28N6O2S.HI/c1-4-27-18(26)15-7-9-25(10-8-15)19(20-12-16-6-5-11-28-16)21-13-17-23-22-14(2)24(17)3;/h5-6,11,15H,4,7-10,12-13H2,1-3H3,(H,20,21);1H |
| InChIKey | XDJZPHDKCKPEAG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|