C18H28N6S — CID 111153871
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,5-dimethyl-N-(thiophen-2-ylmethyl)piperidine-1-carboximidamide (PubChem CID 111153871) has the molecular formula C18H28N6S and a molecular weight of 360.53 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,5-dimethyl-N-(thiophen-2-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,5-dimethyl-N-(thiophen-2-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111153871 |
| Molecular Formula | C18H28N6S |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3,5-dimethyl-N-(thiophen-2-ylmethyl)piperidine-1-carboximidamide |
| SMILES | Cc1nnc(C/N=C(\NCc2cccs2)N2CC(C)CC(C)C2)n1C |
| InChI | InChI=1S/C18H28N6S/c1-13-8-14(2)12-24(11-13)18(19-9-16-6-5-7-25-16)20-10-17-22-21-15(3)23(17)4/h5-7,13-14H,8-12H2,1-4H3,(H,19,20) |
| InChIKey | MQVVLCCMGJFNTM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|