C20H24N6S — CID 110946868
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 110946868) has the molecular formula C20H24N6S and a molecular weight of 380.52 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 110946868 |
| Molecular Formula | C20H24N6S |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | Cc1nnc(C/N=C(\NCc2cccs2)N2CCc3ccccc3C2)n1C |
| InChI | InChI=1S/C20H24N6S/c1-15-23-24-19(25(15)2)13-22-20(21-12-18-8-5-11-27-18)26-10-9-16-6-3-4-7-17(16)14-26/h3-8,11H,9-10,12-14H2,1-2H3,(H,21,22) |
| InChIKey | PAOILJAJXVLZKZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|