C19H28N6O2S — CID 110993827
ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-3-carboxylate (PubChem CID 110993827) has the molecular formula C19H28N6O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110993827 |
| Molecular Formula | C19H28N6O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(/C(=N/Cc2nnc(C)n2C)NCc2cccs2)C1 |
| InChI | InChI=1S/C19H28N6O2S/c1-4-27-18(26)15-7-5-9-25(13-15)19(20-11-16-8-6-10-28-16)21-12-17-23-22-14(2)24(17)3/h6,8,10,15H,4-5,7,9,11-13H2,1-3H3,(H,20,21) |
| InChIKey | YWGWGFAUWZKIOY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|