C19H35IN6O3 — CID 110993822
ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993822) has the molecular formula C19H35IN6O3 and a molecular weight of 522.43 g/mol. Its IUPAC name is ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993822 |
| Molecular Formula | C19H35IN6O3 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | ethyl 1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C19H34N6O3.HI/c1-5-27-12-8-10-20-19(21-13-17-23-22-15(3)24(17)4)25-11-7-9-16(14-25)18(26)28-6-2;/h16H,5-14H2,1-4H3,(H,20,21);1H |
| InChIKey | PTGSTUYUWRVFEO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|