C17H34IN3O3 — CID 110994064
ethyl 1-[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110994064) has the molecular formula C17H34IN3O3 and a molecular weight of 455.38 g/mol. Its IUPAC name is ethyl 1-[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110994064 |
| Molecular Formula | C17H34IN3O3 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | ethyl 1-[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCCCOCCCN/C(=N\C)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C17H33N3O3.HI/c1-4-6-12-22-13-8-10-19-17(18-3)20-11-7-9-15(14-20)16(21)23-5-2;/h15H,4-14H2,1-3H3,(H,18,19);1H |
| InChIKey | FGFFOBFKUCUUHO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|