C14H27N3O3 — CID 110994009
ethyl 1-[N-(3-methoxypropyl)-N'-methylcarbamimidoyl]piperidine-3-carboxylate (PubChem CID 110994009) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is ethyl 1-[N-(3-methoxypropyl)-N'-methylcarbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N-(3-methoxypropyl)-N'-methylcarbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110994009 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | ethyl 1-[N-(3-methoxypropyl)-N'-methylcarbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(/C(=N/C)NCCCOC)C1 |
| InChI | InChI=1S/C14H27N3O3/c1-4-20-13(18)12-7-5-9-17(11-12)14(15-2)16-8-6-10-19-3/h12H,4-11H2,1-3H3,(H,15,16) |
| InChIKey | OYQJJCYPXACBLT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|