C20H39N5O2 — CID 110993475
ethyl 1-[N-[4-(4-ethylpiperazin-1-yl)butyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate (PubChem CID 110993475) has the molecular formula C20H39N5O2 and a molecular weight of 381.57 g/mol. Its IUPAC name is ethyl 1-[N-[4-(4-ethylpiperazin-1-yl)butyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N-[4-(4-ethylpiperazin-1-yl)butyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110993475 |
| Molecular Formula | C20H39N5O2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.31 |
| IUPAC Name | ethyl 1-[N-[4-(4-ethylpiperazin-1-yl)butyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(/C(=N/C)NCCCCN2CCN(CC)CC2)C1 |
| InChI | InChI=1S/C20H39N5O2/c1-4-23-13-15-24(16-14-23)11-7-6-10-22-20(21-3)25-12-8-9-18(17-25)19(26)27-5-2/h18H,4-17H2,1-3H3,(H,21,22) |
| InChIKey | RGPRSLSZQMQVRV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|