C20H31IN4O4 — CID 110993274
ethyl 1-[N-[2-[(4-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993274) has the molecular formula C20H31IN4O4 and a molecular weight of 518.40 g/mol. Its IUPAC name is ethyl 1-[N-[2-[(4-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[2-[(4-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993274 |
| Molecular Formula | C20H31IN4O4 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | ethyl 1-[N-[2-[(4-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCCN(/C(=N/C)NCCNC(=O)c2ccc(OC)cc2)C1.I |
| InChI | InChI=1S/C20H30N4O4.HI/c1-4-28-19(26)16-6-5-13-24(14-16)20(21-2)23-12-11-22-18(25)15-7-9-17(27-3)10-8-15;/h7-10,16H,4-6,11-14H2,1-3H3,(H,21,23)(H,22,25);1H |
| InChIKey | AGWFGURMBGPKFM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|