C20H31IN4O3 — CID 110993628
ethyl 1-[N'-(2-benzamidoethyl)-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993628) has the molecular formula C20H31IN4O3 and a molecular weight of 502.40 g/mol. Its IUPAC name is ethyl 1-[N'-(2-benzamidoethyl)-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-(2-benzamidoethyl)-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993628 |
| Molecular Formula | C20H31IN4O3 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | ethyl 1-[N'-(2-benzamidoethyl)-N-ethylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccccc1)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C20H30N4O3.HI/c1-3-21-20(24-14-8-11-17(15-24)19(26)27-4-2)23-13-12-22-18(25)16-9-6-5-7-10-16;/h5-7,9-10,17H,3-4,8,11-15H2,1-2H3,(H,21,23)(H,22,25);1H |
| InChIKey | AMNFYYWDKIIDAR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|