C21H33IN4O3 — CID 111157641
ethyl 1-[N-ethyl-N'-[2-[(3-methylbenzoyl)amino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111157641) has the molecular formula C21H33IN4O3 and a molecular weight of 516.42 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[2-[(3-methylbenzoyl)amino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[2-[(3-methylbenzoyl)amino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111157641 |
| Molecular Formula | C21H33IN4O3 |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[2-[(3-methylbenzoyl)amino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1cccc(C)c1)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H32N4O3.HI/c1-4-22-21(25-13-9-17(10-14-25)20(27)28-5-2)24-12-11-23-19(26)18-8-6-7-16(3)15-18;/h6-8,15,17H,4-5,9-14H2,1-3H3,(H,22,24)(H,23,26);1H |
| InChIKey | YELOCNOHXXQPFQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|