C21H34IN3O3 — CID 111156538
ethyl 1-[N-ethyl-N'-[2-(2-methoxy-5-methylphenyl)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111156538) has the molecular formula C21H34IN3O3 and a molecular weight of 503.43 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[2-(2-methoxy-5-methylphenyl)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[2-(2-methoxy-5-methylphenyl)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111156538 |
| Molecular Formula | C21H34IN3O3 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[2-(2-methoxy-5-methylphenyl)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCc1cc(C)ccc1OC)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H33N3O3.HI/c1-5-22-21(24-13-10-17(11-14-24)20(25)27-6-2)23-12-9-18-15-16(3)7-8-19(18)26-4;/h7-8,15,17H,5-6,9-14H2,1-4H3,(H,22,23);1H |
| InChIKey | MQWVQJIPPDPYDV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|