C22H35N3O5 — CID 110993081
ethyl 1-[N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]carbamimidoyl]piperidine-3-carboxylate (PubChem CID 110993081) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]carbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]carbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110993081 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[2-(2,3,4-trimethoxyphenyl)ethyl]carbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCN/C(=N\CCc1ccc(OC)c(OC)c1OC)N1CCCC(C(=O)OCC)C1 |
| InChI | InChI=1S/C22H35N3O5/c1-6-23-22(25-14-8-9-17(15-25)21(26)30-7-2)24-13-12-16-10-11-18(27-3)20(29-5)19(16)28-4/h10-11,17H,6-9,12-15H2,1-5H3,(H,23,24) |
| InChIKey | RCHREJFRXJIOAH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|