C20H31N3O4S — CID 110993515
ethyl 1-[N'-[3-(benzenesulfonyl)propyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate (PubChem CID 110993515) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is ethyl 1-[N'-[3-(benzenesulfonyl)propyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N'-[3-(benzenesulfonyl)propyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110993515 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | ethyl 1-[N'-[3-(benzenesulfonyl)propyl]-N-ethylcarbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCN/C(=N\CCCS(=O)(=O)c1ccccc1)N1CCCC(C(=O)OCC)C1 |
| InChI | InChI=1S/C20H31N3O4S/c1-3-21-20(23-14-8-10-17(16-23)19(24)27-4-2)22-13-9-15-28(25,26)18-11-6-5-7-12-18/h5-7,11-12,17H,3-4,8-10,13-16H2,1-2H3,(H,21,22) |
| InChIKey | QFPUZTRDECKWTF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|