C23H31N3O2S — CID 111725107
N'-[3-(benzenesulfonyl)propyl]-3-benzyl-N-ethylpyrrolidine-1-carboximidamide (PubChem CID 111725107) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is N'-[3-(benzenesulfonyl)propyl]-3-benzyl-N-ethylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[3-(benzenesulfonyl)propyl]-3-benzyl-N-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111725107 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N'-[3-(benzenesulfonyl)propyl]-3-benzyl-N-ethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCS(=O)(=O)c1ccccc1)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H31N3O2S/c1-2-24-23(25-15-9-17-29(27,28)22-12-7-4-8-13-22)26-16-14-21(19-26)18-20-10-5-3-6-11-20/h3-8,10-13,21H,2,9,14-19H2,1H3,(H,24,25) |
| InChIKey | NPVRZCUBNXDXGM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|