C15H24IN3O3S — CID 111550027
(3R)-N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111550027) has the molecular formula C15H24IN3O3S and a molecular weight of 453.35 g/mol. Its IUPAC name is (3R)-N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | (3R)-N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111550027 |
| Molecular Formula | C15H24IN3O3S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | (3R)-N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)c1ccccc1)N1CC[C@@H](O)C1.I |
| InChI | InChI=1S/C15H23N3O3S.HI/c1-2-16-15(18-10-8-13(19)12-18)17-9-11-22(20,21)14-6-4-3-5-7-14;/h3-7,13,19H,2,8-12H2,1H3,(H,16,17);1H/t13-;/m1./s1 |
| InChIKey | IQTGTIPBFYUHIH-BTQNPOSSSA-N |
| XLogP | 1.11 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|