C15H23N3O — CID 111551224
(3R)-N-ethyl-3-hydroxy-N'-(2-phenylethyl)pyrrolidine-1-carboximidamide (PubChem CID 111551224) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is (3R)-N-ethyl-3-hydroxy-N'-(2-phenylethyl)pyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N-ethyl-3-hydroxy-N'-(2-phenylethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111551224 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (3R)-N-ethyl-3-hydroxy-N'-(2-phenylethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccccc1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C15H23N3O/c1-2-16-15(18-11-9-14(19)12-18)17-10-8-13-6-4-3-5-7-13/h3-7,14,19H,2,8-12H2,1H3,(H,16,17)/t14-/m1/s1 |
| InChIKey | IHQNDPJSBYSDAW-CQSZACIVSA-N |
| XLogP | 1.26 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|