C17H28IN3O2S2 — CID 109488625
N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109488625) has the molecular formula C17H28IN3O2S2 and a molecular weight of 497.47 g/mol. Its IUPAC name is N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109488625 |
| Molecular Formula | C17H28IN3O2S2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)c1ccccc1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C17H27N3O2S2.HI/c1-4-18-16(20-11-12-23-17(2,3)14-20)19-10-13-24(21,22)15-8-6-5-7-9-15;/h5-9H,4,10-14H2,1-3H3,(H,18,19);1H |
| InChIKey | FLMVOHUSDMFFJE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|