C22H31IN4O3S — CID 111243288
N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-4-(4-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111243288) has the molecular formula C22H31IN4O3S and a molecular weight of 558.49 g/mol. Its IUPAC name is N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-4-(4-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-4-(4-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111243288 |
| Molecular Formula | C22H31IN4O3S |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | N'-[2-(benzenesulfonyl)ethyl]-N-ethyl-4-(4-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)c1ccccc1)N1CCN(c2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C22H30N4O3S.HI/c1-3-23-22(24-13-18-30(27,28)21-7-5-4-6-8-21)26-16-14-25(15-17-26)19-9-11-20(29-2)12-10-19;/h4-12H,3,13-18H2,1-2H3,(H,23,24);1H |
| InChIKey | BNNAODLHQGGURA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|