C18H31IN4O3S — CID 111242880
N-ethyl-N'-(2-ethylsulfonylethyl)-4-(4-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111242880) has the molecular formula C18H31IN4O3S and a molecular weight of 510.44 g/mol. Its IUPAC name is N-ethyl-N'-(2-ethylsulfonylethyl)-4-(4-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-ethylsulfonylethyl)-4-(4-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111242880 |
| Molecular Formula | C18H31IN4O3S |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | N-ethyl-N'-(2-ethylsulfonylethyl)-4-(4-methoxyphenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)CC)N1CCN(c2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C18H30N4O3S.HI/c1-4-19-18(20-10-15-26(23,24)5-2)22-13-11-21(12-14-22)16-6-8-17(25-3)9-7-16;/h6-9H,4-5,10-15H2,1-3H3,(H,19,20);1H |
| InChIKey | IIMHXNGAQDTBTB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|